E-ALE Course Materials
This website holds the course materials for the E-ALE program.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size |
|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | |
![[DIR]](/icons/folder.gif){kind=icon} | examples/ | 2018-10-22 04:19 | - |
| figures/ | 2019-03-07 19:11 | - |
![[ ]](/icons/unknown.gif){kind=icon} | TODO | 2018-10-10 11:05 | 489 |
| faq.xml | 2018-10-10 11:05 | 37K |
| migration.xml | 2018-10-10 11:05 | 278K |
| ref-classes.xml | 2018-10-11 13:06 | 167K |
| ref-devtool-reference.xml | 2018-10-10 11:05 | 33K |
| ref-features.xml | 2018-10-10 11:05 | 27K |
| ref-images.xml | 2018-10-10 11:05 | 9.9K |
| ref-kickstart.xml | 2018-10-10 11:05 | 17K |
| ref-manual-customization.xsl | 2018-10-10 11:05 | 1.2K |
| ref-manual-eclipse-customization.xsl | 2018-10-10 11:05 | 1.4K |
| ref-manual.xml | 2018-10-11 13:06 | 8.6K |
| ref-qa-checks.xml | 2018-10-10 11:05 | 49K |
| ref-release-process.xml | 2018-10-11 13:06 | 11K |
| ref-structure.xml | 2018-10-10 11:05 | 48K |
| ref-system-requirements.xml | 2018-10-11 13:06 | 25K |
| ref-tasks.xml | 2018-10-11 13:06 | 47K |
| ref-terms.xml | 2018-10-11 13:06 | 28K |
| ref-variables.xml | 2018-10-11 13:06 | 860K |
| ref-varlocality.xml | 2018-10-10 11:05 | 10K |
| resources.xml | 2018-10-10 11:05 | 14K |